C20H19Cl2NO4 — CID 42985001
[1-(2,4-dichloroanilino)-1-oxopropan-2-yl] (E)-3-(4-ethoxyphenyl)prop-2-enoate (PubChem CID 42985001) has the molecular formula C20H19Cl2NO4 and a molecular weight of 408.28 g/mol. Its IUPAC name is [1-(2,4-dichloroanilino)-1-oxopropan-2-yl] (E)-3-(4-ethoxyphenyl)prop-2-enoate.
| Compound Name | [1-(2,4-dichloroanilino)-1-oxopropan-2-yl] (E)-3-(4-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 42985001 |
| Molecular Formula | C20H19Cl2NO4 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | [1-(2,4-dichloroanilino)-1-oxopropan-2-yl] (E)-3-(4-ethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(/C=C/C(=O)OC(C)C(=O)Nc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H19Cl2NO4/c1-3-26-16-8-4-14(5-9-16)6-11-19(24)27-13(2)20(25)23-18-10-7-15(21)12-17(18)22/h4-13H,3H2,1-2H3,(H,23,25)/b11-6+ |
| InChIKey | GUGHOOYIBSHEGZ-IZZDOVSWSA-N |
| XLogP | 4.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|