C21H19ClFNO4 — CID 7486141
[(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate (PubChem CID 7486141) has the molecular formula C21H19ClFNO4 and a molecular weight of 403.84 g/mol. Its IUPAC name is [(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7486141 |
| Molecular Formula | C21H19ClFNO4 |
| Molecular Weight | 403.84 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | [(2S)-1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] (E)-3-(4-prop-2-enoxyphenyl)prop-2-enoate |
| SMILES | C=CCOc1ccc(/C=C/C(=O)O[C@@H](C)C(=O)Nc2ccc(F)cc2Cl)cc1 |
| InChI | InChI=1S/C21H19ClFNO4/c1-3-12-27-17-8-4-15(5-9-17)6-11-20(25)28-14(2)21(26)24-19-10-7-16(23)13-18(19)22/h3-11,13-14H,1,12H2,2H3,(H,24,26)/b11-6+/t14-/m0/s1 |
| InChIKey | KEEFEVGCSAFLCY-MUAYPFOZSA-N |
| XLogP | 4.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.84 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|