C22H22ClNO5 — CID 8960272
[(2S)-1-(2,4-dimethylanilino)-1-oxopropan-2-yl] (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoate (PubChem CID 8960272) has the molecular formula C22H22ClNO5 and a molecular weight of 415.87 g/mol. Its IUPAC name is [(2S)-1-(2,4-dimethylanilino)-1-oxopropan-2-yl] (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoate.
| Compound Name | [(2S)-1-(2,4-dimethylanilino)-1-oxopropan-2-yl] (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8960272 |
| Molecular Formula | C22H22ClNO5 |
| Molecular Weight | 415.87 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | [(2S)-1-(2,4-dimethylanilino)-1-oxopropan-2-yl] (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoate |
| SMILES | Cc1ccc(NC(=O)[C@H](C)OC(=O)/C=C/c2cc(Cl)c3c(c2)OCCO3)c(C)c1 |
| InChI | InChI=1S/C22H22ClNO5/c1-13-4-6-18(14(2)10-13)24-22(26)15(3)29-20(25)7-5-16-11-17(23)21-19(12-16)27-8-9-28-21/h4-7,10-12,15H,8-9H2,1-3H3,(H,24,26)/b7-5+/t15-/m0/s1 |
| InChIKey | VALVIZZKXNLACO-ZKKXHLJNSA-N |
| XLogP | 4.31 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.87 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|