C25H31N3O4 — CID 24614091
3-[[(E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoyl]amino]-4-pyrrolidin-1-ylbenzamide (PubChem CID 24614091) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is 3-[[(E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoyl]amino]-4-pyrrolidin-1-ylbenzamide.
| Compound Name | 3-[[(E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoyl]amino]-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 24614091 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 3-[[(E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoyl]amino]-4-pyrrolidin-1-ylbenzamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2cc(C(N)=O)ccc2N2CCCC2)ccc1OCC(C)C |
| InChI | InChI=1S/C25H31N3O4/c1-17(2)16-32-22-10-6-18(14-23(22)31-3)7-11-24(29)27-20-15-19(25(26)30)8-9-21(20)28-12-4-5-13-28/h6-11,14-15,17H,4-5,12-13,16H2,1-3H3,(H2,26,30)(H,27,29)/b11-7+ |
| InChIKey | UCVMBRWREZNSPI-YRNVUSSQSA-N |
| XLogP | 4.08 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|