C24H28ClN3O4 — CID 55554073
3-[3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoylamino]-4-piperidin-1-ylbenzamide (PubChem CID 55554073) has the molecular formula C24H28ClN3O4 and a molecular weight of 457.96 g/mol. Its IUPAC name is 3-[3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoylamino]-4-piperidin-1-ylbenzamide.
| Compound Name | 3-[3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoylamino]-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 55554073 |
| Molecular Formula | C24H28ClN3O4 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 3-[3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoylamino]-4-piperidin-1-ylbenzamide |
| SMILES | CCOc1c(Cl)cc(C=CC(=O)Nc2cc(C(N)=O)ccc2N2CCCCC2)cc1OC |
| InChI | InChI=1S/C24H28ClN3O4/c1-3-32-23-18(25)13-16(14-21(23)31-2)7-10-22(29)27-19-15-17(24(26)30)8-9-20(19)28-11-5-4-6-12-28/h7-10,13-15H,3-6,11-12H2,1-2H3,(H2,26,30)(H,27,29) |
| InChIKey | KSVDGBJWRCSWRT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|