C20H22ClNO3 — CID 26208549
(E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-(2-ethylphenyl)prop-2-enamide (PubChem CID 26208549) has the molecular formula C20H22ClNO3 and a molecular weight of 359.85 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-(2-ethylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-(2-ethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26208549 |
| Molecular Formula | C20H22ClNO3 |
| Molecular Weight | 359.85 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-(2-ethylphenyl)prop-2-enamide |
| SMILES | CCOc1c(Cl)cc(/C=C/C(=O)Nc2ccccc2CC)cc1OC |
| InChI | InChI=1S/C20H22ClNO3/c1-4-15-8-6-7-9-17(15)22-19(23)11-10-14-12-16(21)20(25-5-2)18(13-14)24-3/h6-13H,4-5H2,1-3H3,(H,22,23)/b11-10+ |
| InChIKey | OQUKDENQSOQOSP-ZHACJKMWSA-N |
| XLogP | 4.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.85 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|