C21H24ClNO4 — CID 91941768
3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-[5-(hydroxymethyl)-2,4-dimethylphenyl]prop-2-enamide (PubChem CID 91941768) has the molecular formula C21H24ClNO4 and a molecular weight of 389.88 g/mol. Its IUPAC name is 3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-[5-(hydroxymethyl)-2,4-dimethylphenyl]prop-2-enamide.
| Compound Name | 3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-[5-(hydroxymethyl)-2,4-dimethylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 91941768 |
| Molecular Formula | C21H24ClNO4 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-[5-(hydroxymethyl)-2,4-dimethylphenyl]prop-2-enamide |
| SMILES | CCOc1c(Cl)cc(C=CC(=O)Nc2cc(CO)c(C)cc2C)cc1OC |
| InChI | InChI=1S/C21H24ClNO4/c1-5-27-21-17(22)9-15(10-19(21)26-4)6-7-20(25)23-18-11-16(12-24)13(2)8-14(18)3/h6-11,24H,5,12H2,1-4H3,(H,23,25) |
| InChIKey | ZJWLXGBCCSIVNO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|