C14H15ClF3NO3 — CID 76860857
3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 76860857) has the molecular formula C14H15ClF3NO3 and a molecular weight of 337.73 g/mol. Its IUPAC name is 3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | 3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 76860857 |
| Molecular Formula | C14H15ClF3NO3 |
| Molecular Weight | 337.73 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | CCOc1c(Cl)cc(C=CC(=O)NCC(F)(F)F)cc1OC |
| InChI | InChI=1S/C14H15ClF3NO3/c1-3-22-13-10(15)6-9(7-11(13)21-2)4-5-12(20)19-8-14(16,17)18/h4-7H,3,8H2,1-2H3,(H,19,20) |
| InChIKey | QHXNQVYSRWEDMH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.73 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|