C20H23ClN2O5S — CID 26695431
(E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]prop-2-enamide (PubChem CID 26695431) has the molecular formula C20H23ClN2O5S and a molecular weight of 438.93 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 26695431 |
| Molecular Formula | C20H23ClN2O5S |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]prop-2-enamide |
| SMILES | CCOc1c(Cl)cc(/C=C/C(=O)NCCc2ccc(S(N)(=O)=O)cc2)cc1OC |
| InChI | InChI=1S/C20H23ClN2O5S/c1-3-28-20-17(21)12-15(13-18(20)27-2)6-9-19(24)23-11-10-14-4-7-16(8-5-14)29(22,25)26/h4-9,12-13H,3,10-11H2,1-2H3,(H,23,24)(H2,22,25,26)/b9-6+ |
| InChIKey | BTORVNGODOYKET-RMKNXTFCSA-N |
| XLogP | 2.77 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|