C20H22ClNO4 — CID 17495512
(E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-(2-phenoxyethyl)prop-2-enamide (PubChem CID 17495512) has the molecular formula C20H22ClNO4 and a molecular weight of 375.85 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-(2-phenoxyethyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-(2-phenoxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 17495512 |
| Molecular Formula | C20H22ClNO4 |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-(2-phenoxyethyl)prop-2-enamide |
| SMILES | CCOc1c(Cl)cc(/C=C/C(=O)NCCOc2ccccc2)cc1OC |
| InChI | InChI=1S/C20H22ClNO4/c1-3-25-20-17(21)13-15(14-18(20)24-2)9-10-19(23)22-11-12-26-16-7-5-4-6-8-16/h4-10,13-14H,3,11-12H2,1-2H3,(H,22,23)/b10-9+ |
| InChIKey | YUUFDHMRBCCDCB-MDZDMXLPSA-N |
| XLogP | 3.96 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|