C24H31NO5 — CID 26851284
(E)-N-[2-(3,4-diethoxyphenyl)ethyl]-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 26851284) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is (E)-N-[2-(3,4-diethoxyphenyl)ethyl]-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(3,4-diethoxyphenyl)ethyl]-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26851284 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | (E)-N-[2-(3,4-diethoxyphenyl)ethyl]-3-(4-ethoxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)NCCc2ccc(OCC)c(OCC)c2)cc1OC |
| InChI | InChI=1S/C24H31NO5/c1-5-28-20-11-8-18(16-22(20)27-4)10-13-24(26)25-15-14-19-9-12-21(29-6-2)23(17-19)30-7-3/h8-13,16-17H,5-7,14-15H2,1-4H3,(H,25,26)/b13-10+ |
| InChIKey | RWKPJXHZLNQYFG-JLHYYAGUSA-N |
| XLogP | 4.26 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|