C23H29NO5 — CID 42991733
(E)-N-[2-(3,4-diethoxyphenyl)ethyl]-3-(2,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 42991733) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is (E)-N-[2-(3,4-diethoxyphenyl)ethyl]-3-(2,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(3,4-diethoxyphenyl)ethyl]-3-(2,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 42991733 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (E)-N-[2-(3,4-diethoxyphenyl)ethyl]-3-(2,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(CCNC(=O)/C=C/c2cc(OC)ccc2OC)cc1OCC |
| InChI | InChI=1S/C23H29NO5/c1-5-28-21-10-7-17(15-22(21)29-6-2)13-14-24-23(25)12-8-18-16-19(26-3)9-11-20(18)27-4/h7-12,15-16H,5-6,13-14H2,1-4H3,(H,24,25)/b12-8+ |
| InChIKey | LVLNLRARIRWHDE-XYOKQWHBSA-N |
| XLogP | 3.87 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|