C28H39NO5 — CID 121432743
(E)-3-(5-butoxy-4-methoxy-2-methylphenyl)-N-[2-(3-butoxy-4-methoxyphenyl)ethyl]prop-2-enamide (PubChem CID 121432743) has the molecular formula C28H39NO5 and a molecular weight of 469.62 g/mol. Its IUPAC name is (E)-3-(5-butoxy-4-methoxy-2-methylphenyl)-N-[2-(3-butoxy-4-methoxyphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(5-butoxy-4-methoxy-2-methylphenyl)-N-[2-(3-butoxy-4-methoxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 121432743 |
| Molecular Formula | C28H39NO5 |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | (E)-3-(5-butoxy-4-methoxy-2-methylphenyl)-N-[2-(3-butoxy-4-methoxyphenyl)ethyl]prop-2-enamide |
| SMILES | CCCCOc1cc(CCNC(=O)/C=C/c2cc(OCCCC)c(OC)cc2C)ccc1OC |
| InChI | InChI=1S/C28H39NO5/c1-6-8-16-33-26-19-22(10-12-24(26)31-4)14-15-29-28(30)13-11-23-20-27(34-17-9-7-2)25(32-5)18-21(23)3/h10-13,18-20H,6-9,14-17H2,1-5H3,(H,29,30)/b13-11+ |
| InChIKey | JLWLPCJSPAHCES-ACCUITESSA-N |
| XLogP | 5.74 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|