C28H39NO4 — CID 54554970
3-(4-methoxy-3-pentoxyphenyl)-N-[2-(4-pentoxyphenyl)ethyl]prop-2-enamide (PubChem CID 54554970) has the molecular formula C28H39NO4 and a molecular weight of 453.62 g/mol. Its IUPAC name is 3-(4-methoxy-3-pentoxyphenyl)-N-[2-(4-pentoxyphenyl)ethyl]prop-2-enamide.
| Compound Name | 3-(4-methoxy-3-pentoxyphenyl)-N-[2-(4-pentoxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 54554970 |
| Molecular Formula | C28H39NO4 |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | 3-(4-methoxy-3-pentoxyphenyl)-N-[2-(4-pentoxyphenyl)ethyl]prop-2-enamide |
| SMILES | CCCCCOc1ccc(CCNC(=O)C=Cc2ccc(OC)c(OCCCCC)c2)cc1 |
| InChI | InChI=1S/C28H39NO4/c1-4-6-8-20-32-25-14-10-23(11-15-25)18-19-29-28(30)17-13-24-12-16-26(31-3)27(22-24)33-21-9-7-5-2/h10-17,22H,4-9,18-21H2,1-3H3,(H,29,30) |
| InChIKey | ZMNHSGMBERUTLL-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|