C20H19F4NO4 — CID 18204069
(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[2-[4-(difluoromethoxy)phenyl]ethyl]prop-2-enamide (PubChem CID 18204069) has the molecular formula C20H19F4NO4 and a molecular weight of 413.37 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[2-[4-(difluoromethoxy)phenyl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[2-[4-(difluoromethoxy)phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 18204069 |
| Molecular Formula | C20H19F4NO4 |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[2-[4-(difluoromethoxy)phenyl]ethyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCCc2ccc(OC(F)F)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C20H19F4NO4/c1-27-17-12-14(4-8-16(17)29-20(23)24)5-9-18(26)25-11-10-13-2-6-15(7-3-13)28-19(21)22/h2-9,12,19-20H,10-11H2,1H3,(H,25,26)/b9-5+ |
| InChIKey | UBRJOWZNOYCPEX-WEVVVXLNSA-N |
| XLogP | 4.27 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|