C22H26F2N2O3 — CID 46532496
(E)-N-[3-[benzyl(methyl)amino]propyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide (PubChem CID 46532496) has the molecular formula C22H26F2N2O3 and a molecular weight of 404.46 g/mol. Its IUPAC name is (E)-N-[3-[benzyl(methyl)amino]propyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-N-[3-[benzyl(methyl)amino]propyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 46532496 |
| Molecular Formula | C22H26F2N2O3 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (E)-N-[3-[benzyl(methyl)amino]propyl]-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCCCN(C)Cc2ccccc2)ccc1OC(F)F |
| InChI | InChI=1S/C22H26F2N2O3/c1-26(16-18-7-4-3-5-8-18)14-6-13-25-21(27)12-10-17-9-11-19(29-22(23)24)20(15-17)28-2/h3-5,7-12,15,22H,6,13-14,16H2,1-2H3,(H,25,27)/b12-10+ |
| InChIKey | IXZOCNYAUPNOKD-ZRDIBKRKSA-N |
| XLogP | 3.95 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|