C20H29F3N2O3 — CID 55712971
3-[3-methoxy-4-(2-methylpropoxy)phenyl]-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]prop-2-enamide (PubChem CID 55712971) has the molecular formula C20H29F3N2O3 and a molecular weight of 402.46 g/mol. Its IUPAC name is 3-[3-methoxy-4-(2-methylpropoxy)phenyl]-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]prop-2-enamide.
| Compound Name | 3-[3-methoxy-4-(2-methylpropoxy)phenyl]-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 55712971 |
| Molecular Formula | C20H29F3N2O3 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 3-[3-methoxy-4-(2-methylpropoxy)phenyl]-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)NCCCN(C)CC(F)(F)F)ccc1OCC(C)C |
| InChI | InChI=1S/C20H29F3N2O3/c1-15(2)13-28-17-8-6-16(12-18(17)27-4)7-9-19(26)24-10-5-11-25(3)14-20(21,22)23/h6-9,12,15H,5,10-11,13-14H2,1-4H3,(H,24,26) |
| InChIKey | SQDUKRTTXRESGK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|