C17H23F3N2O3 — CID 46481946
(E)-3-(2,4-dimethoxyphenyl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]prop-2-enamide (PubChem CID 46481946) has the molecular formula C17H23F3N2O3 and a molecular weight of 360.38 g/mol. Its IUPAC name is (E)-3-(2,4-dimethoxyphenyl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dimethoxyphenyl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 46481946 |
| Molecular Formula | C17H23F3N2O3 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (E)-3-(2,4-dimethoxyphenyl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCCCN(C)CC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C17H23F3N2O3/c1-22(12-17(18,19)20)10-4-9-21-16(23)8-6-13-5-7-14(24-2)11-15(13)25-3/h5-8,11H,4,9-10,12H2,1-3H3,(H,21,23)/b8-6+ |
| InChIKey | HHIJOGRHBLBKBV-SOFGYWHQSA-N |
| XLogP | 2.72 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|