C20H24N2O6S — CID 11304701
(E)-3-(2,4-dimethoxyphenyl)-N-[2-(4-methoxy-3-sulfamoylphenyl)ethyl]prop-2-enamide (PubChem CID 11304701) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is (E)-3-(2,4-dimethoxyphenyl)-N-[2-(4-methoxy-3-sulfamoylphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dimethoxyphenyl)-N-[2-(4-methoxy-3-sulfamoylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 11304701 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | (E)-3-(2,4-dimethoxyphenyl)-N-[2-(4-methoxy-3-sulfamoylphenyl)ethyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCCc2ccc(OC)c(S(N)(=O)=O)c2)c(OC)c1 |
| InChI | InChI=1S/C20H24N2O6S/c1-26-16-7-5-15(18(13-16)28-3)6-9-20(23)22-11-10-14-4-8-17(27-2)19(12-14)29(21,24)25/h4-9,12-13H,10-11H2,1-3H3,(H,22,23)(H2,21,24,25)/b9-6+ |
| InChIKey | AWJQYELZJOZODF-RMKNXTFCSA-N |
| XLogP | 1.73 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|