C27H29NO5 — CID 121395814
(E)-3-(2,4-dimethoxyphenyl)-N-[2-(4-methoxy-3-phenylmethoxyphenyl)ethyl]prop-2-enamide (PubChem CID 121395814) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is (E)-3-(2,4-dimethoxyphenyl)-N-[2-(4-methoxy-3-phenylmethoxyphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dimethoxyphenyl)-N-[2-(4-methoxy-3-phenylmethoxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 121395814 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (E)-3-(2,4-dimethoxyphenyl)-N-[2-(4-methoxy-3-phenylmethoxyphenyl)ethyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCCc2ccc(OC)c(OCc3ccccc3)c2)c(OC)c1 |
| InChI | InChI=1S/C27H29NO5/c1-30-23-12-10-22(25(18-23)32-3)11-14-27(29)28-16-15-20-9-13-24(31-2)26(17-20)33-19-21-7-5-4-6-8-21/h4-14,17-18H,15-16,19H2,1-3H3,(H,28,29)/b14-11+ |
| InChIKey | WIVDFCRTXIBYAI-SDNWHVSQSA-N |
| XLogP | 4.66 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|