C31H43NO3 — CID 145106994
ethane;(2E,4E)-N-[2-(4-methoxy-3-phenylmethoxyphenyl)ethyl]-6-methyl-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienamide (PubChem CID 145106994) has the molecular formula C31H43NO3 and a molecular weight of 477.69 g/mol. Its IUPAC name is ethane;(2E,4E)-N-[2-(4-methoxy-3-phenylmethoxyphenyl)ethyl]-6-methyl-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienamide.
| Compound Name | ethane;(2E,4E)-N-[2-(4-methoxy-3-phenylmethoxyphenyl)ethyl]-6-methyl-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 145106994 |
| Molecular Formula | C31H43NO3 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | ethane;(2E,4E)-N-[2-(4-methoxy-3-phenylmethoxyphenyl)ethyl]-6-methyl-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienamide |
| SMILES | C=C(C)/C=C(/C=C\C)\C=C\C(=O)NCCc1ccc(OC)c(OCc2ccccc2)c1.CC.CC |
| InChI | InChI=1S/C27H31NO3.2C2H6/c1-5-9-22(18-21(2)3)13-15-27(29)28-17-16-23-12-14-25(30-4)26(19-23)31-20-24-10-7-6-8-11-24;2*1-2/h5-15,18-19H,2,16-17,20H2,1,3-4H3,(H,28,29);2*1-2H3/b9-5-,15-13+,22-18+;; |
| InChIKey | WGNDBMJGNFCHAD-XVEQXVFDSA-N |
| XLogP | 7.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|