C32H34N2O6 — CID 10506672
1-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 10506672) has the molecular formula C32H34N2O6 and a molecular weight of 542.63 g/mol. Its IUPAC name is 1-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 10506672 |
| Molecular Formula | C32H34N2O6 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 1-[2-[3,4-bis(phenylmethoxy)phenyl]ethyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)NCCc2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C32H34N2O6/c1-36-29-19-26(20-30(37-2)31(29)38-3)34-32(35)33-17-16-23-14-15-27(39-21-24-10-6-4-7-11-24)28(18-23)40-22-25-12-8-5-9-13-25/h4-15,18-20H,16-17,21-22H2,1-3H3,(H2,33,34,35) |
| InChIKey | CDHNLCXYWXSGNO-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |