C27H31NO6 — CID 164862986
4-[2-[3,4-bis(phenylmethoxy)phenyl]ethylamino]-4-oxobutanoic acid;methanol (PubChem CID 164862986) has the molecular formula C27H31NO6 and a molecular weight of 465.55 g/mol. Its IUPAC name is 4-[2-[3,4-bis(phenylmethoxy)phenyl]ethylamino]-4-oxobutanoic acid;methanol.
| Compound Name | 4-[2-[3,4-bis(phenylmethoxy)phenyl]ethylamino]-4-oxobutanoic acid;methanol |
|---|---|
| PubChem CID | 164862986 |
| Molecular Formula | C27H31NO6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 4-[2-[3,4-bis(phenylmethoxy)phenyl]ethylamino]-4-oxobutanoic acid;methanol |
| SMILES | CO.O=C(O)CCC(=O)NCCc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C26H27NO5.CH4O/c28-25(13-14-26(29)30)27-16-15-20-11-12-23(31-18-21-7-3-1-4-8-21)24(17-20)32-19-22-9-5-2-6-10-22;1-2/h1-12,17H,13-16,18-19H2,(H,27,28)(H,29,30);2H,1H3 |
| InChIKey | WJMGGQQSPKWORI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |