C31H37NO7 — CID 164863001
ethene;ethoxycarbonyl 4-[2-[3,4-bis(phenylmethoxy)phenyl]ethylamino]-4-oxobutanoate;molecular hydrogen (PubChem CID 164863001) has the molecular formula C31H37NO7 and a molecular weight of 535.64 g/mol. Its IUPAC name is ethene;ethoxycarbonyl 4-[2-[3,4-bis(phenylmethoxy)phenyl]ethylamino]-4-oxobutanoate;molecular hydrogen.
| Compound Name | ethene;ethoxycarbonyl 4-[2-[3,4-bis(phenylmethoxy)phenyl]ethylamino]-4-oxobutanoate;molecular hydrogen |
|---|---|
| PubChem CID | 164863001 |
| Molecular Formula | C31H37NO7 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | ethene;ethoxycarbonyl 4-[2-[3,4-bis(phenylmethoxy)phenyl]ethylamino]-4-oxobutanoate;molecular hydrogen |
| SMILES | C=C.CCOC(=O)OC(=O)CCC(=O)NCCc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1.[H][H] |
| InChI | InChI=1S/C29H31NO7.C2H4.H2/c1-2-34-29(33)37-28(32)16-15-27(31)30-18-17-22-13-14-25(35-20-23-9-5-3-6-10-23)26(19-22)36-21-24-11-7-4-8-12-24;1-2;/h3-14,19H,2,15-18,20-21H2,1H3,(H,30,31);1-2H2;1H |
| InChIKey | UJVVEZAJEGBODG-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|