C22H24N4O3 — CID 9083294
(E)-3-(1-benzyltriazol-4-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]prop-2-enamide (PubChem CID 9083294) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is (E)-3-(1-benzyltriazol-4-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(1-benzyltriazol-4-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9083294 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (E)-3-(1-benzyltriazol-4-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]prop-2-enamide |
| SMILES | COc1ccc(CCNC(=O)/C=C/c2cn(Cc3ccccc3)nn2)cc1OC |
| InChI | InChI=1S/C22H24N4O3/c1-28-20-10-8-17(14-21(20)29-2)12-13-23-22(27)11-9-19-16-26(25-24-19)15-18-6-4-3-5-7-18/h3-11,14,16H,12-13,15H2,1-2H3,(H,23,27)/b11-9+ |
| InChIKey | BEDQAEUNDQZDAH-PKNBQFBNSA-N |
| XLogP | 2.72 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|