C22H22N4O5 — CID 26694556
methyl 2-[[(E)-3-(1-benzyltriazol-4-yl)prop-2-enoyl]amino]-4,5-dimethoxybenzoate (PubChem CID 26694556) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is methyl 2-[[(E)-3-(1-benzyltriazol-4-yl)prop-2-enoyl]amino]-4,5-dimethoxybenzoate.
| Compound Name | methyl 2-[[(E)-3-(1-benzyltriazol-4-yl)prop-2-enoyl]amino]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 26694556 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | methyl 2-[[(E)-3-(1-benzyltriazol-4-yl)prop-2-enoyl]amino]-4,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1NC(=O)/C=C/c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C22H22N4O5/c1-29-19-11-17(22(28)31-3)18(12-20(19)30-2)23-21(27)10-9-16-14-26(25-24-16)13-15-7-5-4-6-8-15/h4-12,14H,13H2,1-3H3,(H,23,27)/b10-9+ |
| InChIKey | TVCRDQPTBYBDDO-MDZDMXLPSA-N |
| XLogP | 2.78 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|