C26H28N2O6S — CID 18318624
(E)-3-(2,4-dimethoxyphenyl)-N-[2-(4-phenylmethoxy-3-sulfamoylphenyl)ethyl]prop-2-enamide (PubChem CID 18318624) has the molecular formula C26H28N2O6S and a molecular weight of 496.59 g/mol. Its IUPAC name is (E)-3-(2,4-dimethoxyphenyl)-N-[2-(4-phenylmethoxy-3-sulfamoylphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dimethoxyphenyl)-N-[2-(4-phenylmethoxy-3-sulfamoylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 18318624 |
| Molecular Formula | C26H28N2O6S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | (E)-3-(2,4-dimethoxyphenyl)-N-[2-(4-phenylmethoxy-3-sulfamoylphenyl)ethyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCCc2ccc(OCc3ccccc3)c(S(N)(=O)=O)c2)c(OC)c1 |
| InChI | InChI=1S/C26H28N2O6S/c1-32-22-11-9-21(24(17-22)33-2)10-13-26(29)28-15-14-19-8-12-23(25(16-19)35(27,30)31)34-18-20-6-4-3-5-7-20/h3-13,16-17H,14-15,18H2,1-2H3,(H,28,29)(H2,27,30,31)/b13-10+ |
| InChIKey | AEERVGYFVDVLDH-JLHYYAGUSA-N |
| XLogP | 3.30 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|