C18H20N2O5S — CID 2684663
(E)-3-(2,5-dimethoxyphenyl)-N-[(4-sulfamoylphenyl)methyl]prop-2-enamide (PubChem CID 2684663) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is (E)-3-(2,5-dimethoxyphenyl)-N-[(4-sulfamoylphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2,5-dimethoxyphenyl)-N-[(4-sulfamoylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 2684663 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (E)-3-(2,5-dimethoxyphenyl)-N-[(4-sulfamoylphenyl)methyl]prop-2-enamide |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)NCc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C18H20N2O5S/c1-24-15-6-9-17(25-2)14(11-15)5-10-18(21)20-12-13-3-7-16(8-4-13)26(19,22)23/h3-11H,12H2,1-2H3,(H,20,21)(H2,19,22,23)/b10-5+ |
| InChIKey | IZMOXMCSVDOZBZ-BJMVGYQFSA-N |
| XLogP | 1.68 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|