C16H19N3O4S2 — CID 1324283
1-(2,5-dimethoxyphenyl)-3-[(4-sulfamoylphenyl)methyl]thiourea (PubChem CID 1324283) has the molecular formula C16H19N3O4S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-[(4-sulfamoylphenyl)methyl]thiourea.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-[(4-sulfamoylphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 1324283 |
| Molecular Formula | C16H19N3O4S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-[(4-sulfamoylphenyl)methyl]thiourea |
| SMILES | COc1ccc(OC)c(NC(=S)NCc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C16H19N3O4S2/c1-22-12-5-8-15(23-2)14(9-12)19-16(24)18-10-11-3-6-13(7-4-11)25(17,20)21/h3-9H,10H2,1-2H3,(H2,17,20,21)(H2,18,19,24) |
| InChIKey | MAODCHAIVAHOFG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|