C17H21N3O5S — CID 108989677
1-(2,4-dimethoxyphenyl)-3-[2-(4-sulfamoylphenyl)ethyl]urea (PubChem CID 108989677) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-[2-(4-sulfamoylphenyl)ethyl]urea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-[2-(4-sulfamoylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108989677 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-[2-(4-sulfamoylphenyl)ethyl]urea |
| SMILES | COc1ccc(NC(=O)NCCc2ccc(S(N)(=O)=O)cc2)c(OC)c1 |
| InChI | InChI=1S/C17H21N3O5S/c1-24-13-5-8-15(16(11-13)25-2)20-17(21)19-10-9-12-3-6-14(7-4-12)26(18,22)23/h3-8,11H,9-10H2,1-2H3,(H2,18,22,23)(H2,19,20,21) |
| InChIKey | JDOFHHXPFQBCOF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |