C20H28N4O4S — CID 111878913
2-[(2,4-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine (PubChem CID 111878913) has the molecular formula C20H28N4O4S and a molecular weight of 420.54 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine.
| Compound Name | 2-[(2,4-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111878913 |
| Molecular Formula | C20H28N4O4S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)cc1OC)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H28N4O4S/c1-4-22-20(24-14-16-7-8-17(27-2)13-19(16)28-3)23-12-11-15-5-9-18(10-6-15)29(21,25)26/h5-10,13H,4,11-12,14H2,1-3H3,(H2,21,25,26)(H2,22,23,24) |
| InChIKey | LGLWSAGQYGVTQE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|