C16H28IN3O4S — CID 111879914
2-[(2,4-dimethoxyphenyl)methyl]-1-ethyl-3-(2-ethylsulfonylethyl)guanidine;hydroiodide (PubChem CID 111879914) has the molecular formula C16H28IN3O4S and a molecular weight of 485.39 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)methyl]-1-ethyl-3-(2-ethylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 2-[(2,4-dimethoxyphenyl)methyl]-1-ethyl-3-(2-ethylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111879914 |
| Molecular Formula | C16H28IN3O4S |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)methyl]-1-ethyl-3-(2-ethylsulfonylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)cc1OC)NCCS(=O)(=O)CC.I |
| InChI | InChI=1S/C16H27N3O4S.HI/c1-5-17-16(18-9-10-24(20,21)6-2)19-12-13-7-8-14(22-3)11-15(13)23-4;/h7-8,11H,5-6,9-10,12H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | BKPULFHJPAEZGG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|