C17H29N3O5S — CID 111671372
2-[(2,4-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine (PubChem CID 111671372) has the molecular formula C17H29N3O5S and a molecular weight of 387.50 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine.
| Compound Name | 2-[(2,4-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 111671372 |
| Molecular Formula | C17H29N3O5S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)methyl]-1-ethyl-3-[2-(2-methylsulfonylethoxy)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)cc1OC)NCCOCCS(C)(=O)=O |
| InChI | InChI=1S/C17H29N3O5S/c1-5-18-17(19-8-9-25-10-11-26(4,21)22)20-13-14-6-7-15(23-2)12-16(14)24-3/h6-7,12H,5,8-11,13H2,1-4H3,(H2,18,19,20) |
| InChIKey | IWMYCHYJYLXWNM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|