C17H22N4O7S2 — CID 162667381
1-(2,4-dimethoxyphenyl)-3-[2-[(4-sulfamoylphenyl)sulfamoyl]ethyl]urea (PubChem CID 162667381) has the molecular formula C17H22N4O7S2 and a molecular weight of 458.52 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-[2-[(4-sulfamoylphenyl)sulfamoyl]ethyl]urea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-[2-[(4-sulfamoylphenyl)sulfamoyl]ethyl]urea |
|---|---|
| PubChem CID | 162667381 |
| Molecular Formula | C17H22N4O7S2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-[2-[(4-sulfamoylphenyl)sulfamoyl]ethyl]urea |
| SMILES | COc1ccc(NC(=O)NCCS(=O)(=O)Nc2ccc(S(N)(=O)=O)cc2)c(OC)c1 |
| InChI | InChI=1S/C17H22N4O7S2/c1-27-13-5-8-15(16(11-13)28-2)20-17(22)19-9-10-29(23,24)21-12-3-6-14(7-4-12)30(18,25)26/h3-8,11,21H,9-10H2,1-2H3,(H2,18,25,26)(H2,19,20,22) |
| InChIKey | YHDQKRLQEYIZTD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 165.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |