C15H15IN2O3 — CID 2209592
1-(2,4-dimethoxyphenyl)-3-(4-iodophenyl)urea (PubChem CID 2209592) has the molecular formula C15H15IN2O3 and a molecular weight of 398.20 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-(4-iodophenyl)urea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-(4-iodophenyl)urea |
|---|---|
| PubChem CID | 2209592 |
| Molecular Formula | C15H15IN2O3 |
| Molecular Weight | 398.20 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-(4-iodophenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(I)cc2)c(OC)c1 |
| InChI | InChI=1S/C15H15IN2O3/c1-20-12-7-8-13(14(9-12)21-2)18-15(19)17-11-5-3-10(16)4-6-11/h3-9H,1-2H3,(H2,17,18,19) |
| InChIKey | JVPTXHMISXQOTJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.20 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|