C10H11N3O3 — CID 20559814
1-cyano-3-(2,4-dimethoxyphenyl)urea (PubChem CID 20559814) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is 1-cyano-3-(2,4-dimethoxyphenyl)urea.
| Compound Name | 1-cyano-3-(2,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 20559814 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 1-cyano-3-(2,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NC#N)c(OC)c1 |
| InChI | InChI=1S/C10H11N3O3/c1-15-7-3-4-8(9(5-7)16-2)13-10(14)12-6-11/h3-5H,1-2H3,(H2,12,13,14) |
| InChIKey | CGRDFNZBYLGGHK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|