C12H15NO3 — CID 101065891
N-(2,4-dimethoxyphenyl)-2-methylprop-2-enamide (PubChem CID 101065891) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-methylprop-2-enamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 101065891 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1ccc(OC)cc1OC |
| InChI | InChI=1S/C12H15NO3/c1-8(2)12(14)13-10-6-5-9(15-3)7-11(10)16-4/h5-7H,1H2,2-4H3,(H,13,14) |
| InChIKey | LCQLRKLRCISKAS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|