C19H22N2O7 — CID 108987426
N-(2,4-dimethoxyphenyl)-N'-(3,4,5-trimethoxyphenyl)oxamide (PubChem CID 108987426) has the molecular formula C19H22N2O7 and a molecular weight of 390.39 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-N'-(3,4,5-trimethoxyphenyl)oxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-N'-(3,4,5-trimethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 108987426 |
| Molecular Formula | C19H22N2O7 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-N'-(3,4,5-trimethoxyphenyl)oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)Nc2cc(OC)c(OC)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C19H22N2O7/c1-24-12-6-7-13(14(10-12)25-2)21-19(23)18(22)20-11-8-15(26-3)17(28-5)16(9-11)27-4/h6-10H,1-5H3,(H,20,22)(H,21,23) |
| InChIKey | UOBQUXUXXCGOLQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|