C19H20N2O6 — CID 108987472
N-(4-acetylphenyl)-N'-(3,4,5-trimethoxyphenyl)oxamide (PubChem CID 108987472) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N'-(3,4,5-trimethoxyphenyl)oxamide.
| Compound Name | N-(4-acetylphenyl)-N'-(3,4,5-trimethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 108987472 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | N-(4-acetylphenyl)-N'-(3,4,5-trimethoxyphenyl)oxamide |
| SMILES | COc1cc(NC(=O)C(=O)Nc2ccc(C(C)=O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H20N2O6/c1-11(22)12-5-7-13(8-6-12)20-18(23)19(24)21-14-9-15(25-2)17(27-4)16(10-14)26-3/h5-10H,1-4H3,(H,20,23)(H,21,24) |
| InChIKey | NFMAAQCQXXCQAF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|