C17H20N2O5 — CID 112989491
methyl N-[4-(3,4,5-trimethoxyanilino)phenyl]carbamate (PubChem CID 112989491) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is methyl N-[4-(3,4,5-trimethoxyanilino)phenyl]carbamate.
| Compound Name | methyl N-[4-(3,4,5-trimethoxyanilino)phenyl]carbamate |
|---|---|
| PubChem CID | 112989491 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | methyl N-[4-(3,4,5-trimethoxyanilino)phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(Nc2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C17H20N2O5/c1-21-14-9-13(10-15(22-2)16(14)23-3)18-11-5-7-12(8-6-11)19-17(20)24-4/h5-10,18H,1-4H3,(H,19,20) |
| InChIKey | HIALUAWHTSBKDN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |