C21H29IN4O5 — CID 111376149
methyl N-[4-[[[N'-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]methyl]phenyl]carbamate;hydroiodide (PubChem CID 111376149) has the molecular formula C21H29IN4O5 and a molecular weight of 544.39 g/mol. Its IUPAC name is methyl N-[4-[[[N'-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]methyl]phenyl]carbamate;hydroiodide.
| Compound Name | methyl N-[4-[[[N'-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]methyl]phenyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111376149 |
| Molecular Formula | C21H29IN4O5 |
| Molecular Weight | 544.39 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | methyl N-[4-[[[N'-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]methyl]phenyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(NC(=O)OC)cc1)NCc1cc(OC)c(OC)c(OC)c1.I |
| InChI | InChI=1S/C21H28N4O5.HI/c1-22-20(23-12-14-6-8-16(9-7-14)25-21(26)30-5)24-13-15-10-17(27-2)19(29-4)18(11-15)28-3;/h6-11H,12-13H2,1-5H3,(H,25,26)(H2,22,23,24);1H |
| InChIKey | YKFFZISYSDRYMX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|