C22H32IN3O6 — CID 111376591
2-methyl-1,3-bis[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111376591) has the molecular formula C22H32IN3O6 and a molecular weight of 561.42 g/mol. Its IUPAC name is 2-methyl-1,3-bis[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1,3-bis[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111376591 |
| Molecular Formula | C22H32IN3O6 |
| Molecular Weight | 561.42 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | 2-methyl-1,3-bis[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CN=C(NCc1cc(OC)c(OC)c(OC)c1)NCc1cc(OC)c(OC)c(OC)c1.I |
| InChI | InChI=1S/C22H31N3O6.HI/c1-23-22(24-12-14-8-16(26-2)20(30-6)17(9-14)27-3)25-13-15-10-18(28-4)21(31-7)19(11-15)29-5;/h8-11H,12-13H2,1-7H3,(H2,23,24,25);1H |
| InChIKey | YKHBGBLRPUYHDA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|