C22H30IN3O6 — CID 111376377
methyl 2-methoxy-5-[[[N'-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]methyl]benzoate;hydroiodide (PubChem CID 111376377) has the molecular formula C22H30IN3O6 and a molecular weight of 559.40 g/mol. Its IUPAC name is methyl 2-methoxy-5-[[[N'-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]methyl]benzoate;hydroiodide.
| Compound Name | methyl 2-methoxy-5-[[[N'-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]methyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111376377 |
| Molecular Formula | C22H30IN3O6 |
| Molecular Weight | 559.40 g/mol |
| Exact Mass | 559.12 |
| IUPAC Name | methyl 2-methoxy-5-[[[N'-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]methyl]benzoate;hydroiodide |
| SMILES | C/N=C(/NCc1cc(OC)c(OC)c(OC)c1)NCc1ccc(OC)c(C(=O)OC)c1.I |
| InChI | InChI=1S/C22H29N3O6.HI/c1-23-22(24-12-14-7-8-17(27-2)16(9-14)21(26)31-6)25-13-15-10-18(28-3)20(30-5)19(11-15)29-4;/h7-11H,12-13H2,1-6H3,(H2,23,24,25);1H |
| InChIKey | QTJHDLWXNXTYQC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|