C22H29IN4O4 — CID 111873610
methyl 5-[[[N-[[4-(dimethylcarbamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methoxybenzoate;hydroiodide (PubChem CID 111873610) has the molecular formula C22H29IN4O4 and a molecular weight of 540.40 g/mol. Its IUPAC name is methyl 5-[[[N-[[4-(dimethylcarbamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methoxybenzoate;hydroiodide.
| Compound Name | methyl 5-[[[N-[[4-(dimethylcarbamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methoxybenzoate;hydroiodide |
|---|---|
| PubChem CID | 111873610 |
| Molecular Formula | C22H29IN4O4 |
| Molecular Weight | 540.40 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | methyl 5-[[[N-[[4-(dimethylcarbamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methoxybenzoate;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C(=O)N(C)C)cc1)NCc1ccc(OC)c(C(=O)OC)c1.I |
| InChI | InChI=1S/C22H28N4O4.HI/c1-23-22(24-13-15-6-9-17(10-7-15)20(27)26(2)3)25-14-16-8-11-19(29-4)18(12-16)21(28)30-5;/h6-12H,13-14H2,1-5H3,(H2,23,24,25);1H |
| InChIKey | DFWLONZDFJXIAV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|