C21H28IN3O5 — CID 111878780
methyl 5-[[[N-[(2,4-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methoxybenzoate;hydroiodide (PubChem CID 111878780) has the molecular formula C21H28IN3O5 and a molecular weight of 529.38 g/mol. Its IUPAC name is methyl 5-[[[N-[(2,4-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methoxybenzoate;hydroiodide.
| Compound Name | methyl 5-[[[N-[(2,4-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methoxybenzoate;hydroiodide |
|---|---|
| PubChem CID | 111878780 |
| Molecular Formula | C21H28IN3O5 |
| Molecular Weight | 529.38 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | methyl 5-[[[N-[(2,4-dimethoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]-2-methoxybenzoate;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OC)c(C(=O)OC)c1)NCc1ccc(OC)cc1OC.I |
| InChI | InChI=1S/C21H27N3O5.HI/c1-22-21(24-13-15-7-8-16(26-2)11-19(15)28-4)23-12-14-6-9-18(27-3)17(10-14)20(25)29-5;/h6-11H,12-13H2,1-5H3,(H2,22,23,24);1H |
| InChIKey | DGCAAIKSOFROOO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|