C22H30IN3O5 — CID 111679951
methyl 2-methoxy-5-[[[N-[2-(3-methoxyphenoxy)propyl]-N'-methylcarbamimidoyl]amino]methyl]benzoate;hydroiodide (PubChem CID 111679951) has the molecular formula C22H30IN3O5 and a molecular weight of 543.40 g/mol. Its IUPAC name is methyl 2-methoxy-5-[[[N-[2-(3-methoxyphenoxy)propyl]-N'-methylcarbamimidoyl]amino]methyl]benzoate;hydroiodide.
| Compound Name | methyl 2-methoxy-5-[[[N-[2-(3-methoxyphenoxy)propyl]-N'-methylcarbamimidoyl]amino]methyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111679951 |
| Molecular Formula | C22H30IN3O5 |
| Molecular Weight | 543.40 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | methyl 2-methoxy-5-[[[N-[2-(3-methoxyphenoxy)propyl]-N'-methylcarbamimidoyl]amino]methyl]benzoate;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OC)c(C(=O)OC)c1)NCC(C)Oc1cccc(OC)c1.I |
| InChI | InChI=1S/C22H29N3O5.HI/c1-15(30-18-8-6-7-17(12-18)27-3)13-24-22(23-2)25-14-16-9-10-20(28-4)19(11-16)21(26)29-5;/h6-12,15H,13-14H2,1-5H3,(H2,23,24,25);1H |
| InChIKey | LXAUMFBGSLOJQU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|