C17H22IN3O3S — CID 111259490
methyl 2-methoxy-5-[[[N'-methyl-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]methyl]benzoate;hydroiodide (PubChem CID 111259490) has the molecular formula C17H22IN3O3S and a molecular weight of 475.35 g/mol. Its IUPAC name is methyl 2-methoxy-5-[[[N'-methyl-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]methyl]benzoate;hydroiodide.
| Compound Name | methyl 2-methoxy-5-[[[N'-methyl-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]methyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111259490 |
| Molecular Formula | C17H22IN3O3S |
| Molecular Weight | 475.35 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | methyl 2-methoxy-5-[[[N'-methyl-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]methyl]benzoate;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OC)c(C(=O)OC)c1)NCc1cccs1.I |
| InChI | InChI=1S/C17H21N3O3S.HI/c1-18-17(20-11-13-5-4-8-24-13)19-10-12-6-7-15(22-2)14(9-12)16(21)23-3;/h4-9H,10-11H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | AEKWULSGWXFCTB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|