C20H24N2O4 — CID 112989494
N-[4-(3,4,5-trimethoxyanilino)phenyl]cyclobutanecarboxamide (PubChem CID 112989494) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is N-[4-(3,4,5-trimethoxyanilino)phenyl]cyclobutanecarboxamide.
| Compound Name | N-[4-(3,4,5-trimethoxyanilino)phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 112989494 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N-[4-(3,4,5-trimethoxyanilino)phenyl]cyclobutanecarboxamide |
| SMILES | COc1cc(Nc2ccc(NC(=O)C3CCC3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H24N2O4/c1-24-17-11-16(12-18(25-2)19(17)26-3)21-14-7-9-15(10-8-14)22-20(23)13-5-4-6-13/h7-13,21H,4-6H2,1-3H3,(H,22,23) |
| InChIKey | NASZTOIIOABMBG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |