C15H20N2O3 — CID 131935340
5-(cyclobutanecarbonylamino)-2-methoxy-N,N-dimethylbenzamide (PubChem CID 131935340) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 5-(cyclobutanecarbonylamino)-2-methoxy-N,N-dimethylbenzamide.
| Compound Name | 5-(cyclobutanecarbonylamino)-2-methoxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 131935340 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 5-(cyclobutanecarbonylamino)-2-methoxy-N,N-dimethylbenzamide |
| SMILES | COc1ccc(NC(=O)C2CCC2)cc1C(=O)N(C)C |
| InChI | InChI=1S/C15H20N2O3/c1-17(2)15(19)12-9-11(7-8-13(12)20-3)16-14(18)10-5-4-6-10/h7-10H,4-6H2,1-3H3,(H,16,18) |
| InChIKey | YMNHCZUYFIDTCB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |