C12H17N3O3 — CID 74241829
2-methoxy-N,N-dimethyl-5-(methylcarbamoylamino)benzamide (PubChem CID 74241829) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-methoxy-N,N-dimethyl-5-(methylcarbamoylamino)benzamide.
| Compound Name | 2-methoxy-N,N-dimethyl-5-(methylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 74241829 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-methoxy-N,N-dimethyl-5-(methylcarbamoylamino)benzamide |
| SMILES | CNC(=O)Nc1ccc(OC)c(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C12H17N3O3/c1-13-12(17)14-8-5-6-10(18-4)9(7-8)11(16)15(2)3/h5-7H,1-4H3,(H2,13,14,17) |
| InChIKey | AQTWQQDHSFJNHG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |